C21H25F6NO4P2 — CID 15352789
2-diphenylphosphoryl-N-di(propan-2-yloxy)phosphoryl-1,1,1,3,3,3-hexafluoropropan-2-amine (PubChem CID 15352789) has the molecular formula C21H25F6NO4P2 and a molecular weight of 531.37 g/mol. Its IUPAC name is 2-diphenylphosphoryl-N-di(propan-2-yloxy)phosphoryl-1,1,1,3,3,3-hexafluoropropan-2-amine.
| Compound Name | 2-diphenylphosphoryl-N-di(propan-2-yloxy)phosphoryl-1,1,1,3,3,3-hexafluoropropan-2-amine |
|---|---|
| PubChem CID | 15352789 |
| Molecular Formula | C21H25F6NO4P2 |
| Molecular Weight | 531.37 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | 2-diphenylphosphoryl-N-di(propan-2-yloxy)phosphoryl-1,1,1,3,3,3-hexafluoropropan-2-amine |
| SMILES | CC(C)OP(=O)(NC(C(F)(F)F)(C(F)(F)F)P(=O)(c1ccccc1)c1ccccc1)OC(C)C |
| InChI | InChI=1S/C21H25F6NO4P2/c1-15(2)31-34(30,32-16(3)4)28-19(20(22,23)24,21(25,26)27)33(29,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-16H,1-4H3,(H,28,30) |
| InChIKey | BKMQGZAEIPPMHD-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.37 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|