C13H20O6 — CID 15360353
methyl 3-methyl-5-[(E)-7-oxooct-5-enyl]-1,2,4-trioxolane-3-carboxylate (PubChem CID 15360353) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is methyl 3-methyl-5-[(E)-7-oxooct-5-enyl]-1,2,4-trioxolane-3-carboxylate.
| Compound Name | methyl 3-methyl-5-[(E)-7-oxooct-5-enyl]-1,2,4-trioxolane-3-carboxylate |
|---|---|
| PubChem CID | 15360353 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | methyl 3-methyl-5-[(E)-7-oxooct-5-enyl]-1,2,4-trioxolane-3-carboxylate |
| SMILES | COC(=O)C1(C)OOC(CCCC/C=C/C(C)=O)O1 |
| InChI | InChI=1S/C13H20O6/c1-10(14)8-6-4-5-7-9-11-17-13(2,19-18-11)12(15)16-3/h6,8,11H,4-5,7,9H2,1-3H3/b8-6+ |
| InChIKey | QVQFLQFDEBWUIK-SOFGYWHQSA-N |
| XLogP | 1.89 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|