C43H21BF15P — CID 15360875
tris(2,3,4,5,6-pentafluorophenyl)-[phenyl(triphenylphosphaniumyl)methyl]boranuide (PubChem CID 15360875) has the molecular formula C43H21BF15P and a molecular weight of 864.40 g/mol. Its IUPAC name is tris(2,3,4,5,6-pentafluorophenyl)-[phenyl(triphenylphosphaniumyl)methyl]boranuide.
| Compound Name | tris(2,3,4,5,6-pentafluorophenyl)-[phenyl(triphenylphosphaniumyl)methyl]boranuide |
|---|---|
| PubChem CID | 15360875 |
| Molecular Formula | C43H21BF15P |
| Molecular Weight | 864.40 g/mol |
| Exact Mass | 864.12 |
| IUPAC Name | tris(2,3,4,5,6-pentafluorophenyl)-[phenyl(triphenylphosphaniumyl)methyl]boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)C(c2ccccc2)[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C43H21BF15P/c45-28-25(29(46)35(52)40(57)34(28)51)44(26-30(47)36(53)41(58)37(54)31(26)48,27-32(49)38(55)42(59)39(56)33(27)50)43(21-13-5-1-6-14-21)60(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20,43H |
| InChIKey | MZGJLZYYZJMXBT-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.40 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|