C22H24FN3O3S — CID 15370855
[4-ethyl-7-fluoro-6-(4-methylpiperazin-1-yl)-1,1-dioxo-1lambda6,4-benzothiazin-2-yl]-phenylmethanone (PubChem CID 15370855) has the molecular formula C22H24FN3O3S and a molecular weight of 429.52 g/mol. Its IUPAC name is [4-ethyl-7-fluoro-6-(4-methylpiperazin-1-yl)-1,1-dioxo-1lambda6,4-benzothiazin-2-yl]-phenylmethanone.
| Compound Name | [4-ethyl-7-fluoro-6-(4-methylpiperazin-1-yl)-1,1-dioxo-1lambda6,4-benzothiazin-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 15370855 |
| Molecular Formula | C22H24FN3O3S |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | [4-ethyl-7-fluoro-6-(4-methylpiperazin-1-yl)-1,1-dioxo-1lambda6,4-benzothiazin-2-yl]-phenylmethanone |
| SMILES | CCN1C=C(C(=O)c2ccccc2)S(=O)(=O)c2cc(F)c(N3CCN(C)CC3)cc21 |
| InChI | InChI=1S/C22H24FN3O3S/c1-3-25-15-21(22(27)16-7-5-4-6-8-16)30(28,29)20-13-17(23)18(14-19(20)25)26-11-9-24(2)10-12-26/h4-8,13-15H,3,9-12H2,1-2H3 |
| InChIKey | QPFLUFWAQLVQPI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'} |
|---|