C10H14ClNO2 — CID 15397191
5-(chloromethyl)-N,N-diethylfuran-3-carboxamide (PubChem CID 15397191) has the molecular formula C10H14ClNO2 and a molecular weight of 215.68 g/mol. Its IUPAC name is 5-(chloromethyl)-N,N-diethylfuran-3-carboxamide.
| Compound Name | 5-(chloromethyl)-N,N-diethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 15397191 |
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 5-(chloromethyl)-N,N-diethylfuran-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1coc(CCl)c1 |
| InChI | InChI=1S/C10H14ClNO2/c1-3-12(4-2)10(13)8-5-9(6-11)14-7-8/h5,7H,3-4,6H2,1-2H3 |
| InChIKey | KENSFLCPFMBTBE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|