C14H20Se2 — CID 15399225
[(Z)-1,2-bis(propylselanyl)ethenyl]benzene (PubChem CID 15399225) has the molecular formula C14H20Se2 and a molecular weight of 346.23 g/mol. Its IUPAC name is [(Z)-1,2-bis(propylselanyl)ethenyl]benzene.
| Compound Name | [(Z)-1,2-bis(propylselanyl)ethenyl]benzene |
|---|---|
| PubChem CID | 15399225 |
| Molecular Formula | C14H20Se2 |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | [(Z)-1,2-bis(propylselanyl)ethenyl]benzene |
| SMILES | CCC[Se]/C=C(\[Se]CCC)c1ccccc1 |
| InChI | InChI=1S/C14H20Se2/c1-3-10-15-12-14(16-11-4-2)13-8-6-5-7-9-13/h5-9,12H,3-4,10-11H2,1-2H3/b14-12- |
| InChIKey | NXHVADMWLDXMJP-OWBHPGMISA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|