About [(E)-1,2-bis(methylselanyl)ethenyl]benzene
[(E)-1,2-bis(methylselanyl)ethenyl]benzene (PubChem CID 15635882) has the molecular formula C10H12Se2
and a molecular weight of 290.13 g/mol. Its IUPAC name is [(E)-1,2-bis(methylselanyl)ethenyl]benzene.
Molecular Properties
| Compound Name | [(E)-1,2-bis(methylselanyl)ethenyl]benzene |
| PubChem CID | 15635882 |
| Molecular Formula | C10H12Se2 |
| Molecular Weight | 290.13 g/mol |
| Exact Mass | 291.93 |
| IUPAC Name | [(E)-1,2-bis(methylselanyl)ethenyl]benzene |
| SMILES | C[Se]/C=C(/[Se]C)c1ccccc1 |
| InChI | InChI=1S/C10H12Se2/c1-11-8-10(12-2)9-6-4-3-5-7-9/h3-8H,1-2H3/b10-8+ |
| InChIKey | UUJJHARXAFVTFY-CSKARUKUSA-N |
| XLogP | 2.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.13 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1,2-bis(methylselanyl)ethenyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1,2-bis(methylselanyl)ethenyl]benzene?
The IUPAC name of [(E)-1,2-bis(methylselanyl)ethenyl]benzene (CID 15635882) is [(E)-1,2-bis(methylselanyl)ethenyl]benzene.
What is the SMILES notation for [(E)-1,2-bis(methylselanyl)ethenyl]benzene?
The canonical SMILES for [(E)-1,2-bis(methylselanyl)ethenyl]benzene is C[Se]/C=C(/[Se]C)c1ccccc1.
What is the InChIKey of [(E)-1,2-bis(methylselanyl)ethenyl]benzene?
The InChIKey is UUJJHARXAFVTFY-CSKARUKUSA-N. The full InChI is InChI=1S/C10H12Se2/c1-11-8-10(12-2)9-6-4-3-5-7-9/h3-8H,1-2H3/b10-8+.
What are the key properties of [(E)-1,2-bis(methylselanyl)ethenyl]benzene?
[(E)-1,2-bis(methylselanyl)ethenyl]benzene has a molecular weight of 290.13 g/mol, XLogP of 2.49, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1,2-bis(methylselanyl)ethenyl]benzene is sourced from PubChem (CID 15635882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).