C30H43N5O3Si — CID 154012475
tert-butyl N-[2-[[5-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]anilino]-4-pyridinyl]-2-pyridinyl]amino]ethyl]carbamate (PubChem CID 154012475) has the molecular formula C30H43N5O3Si and a molecular weight of 549.79 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]anilino]-4-pyridinyl]-2-pyridinyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]anilino]-4-pyridinyl]-2-pyridinyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 154012475 |
| Molecular Formula | C30H43N5O3Si |
| Molecular Weight | 549.79 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | tert-butyl N-[2-[[5-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]anilino]-4-pyridinyl]-2-pyridinyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1ccc(-c2ccnc(Nc3cccc(CO[Si](C)(C)C(C)(C)C)c3)c2)cn1 |
| InChI | InChI=1S/C30H43N5O3Si/c1-29(2,3)38-28(36)33-17-16-32-26-13-12-24(20-34-26)23-14-15-31-27(19-23)35-25-11-9-10-22(18-25)21-37-39(7,8)30(4,5)6/h9-15,18-20H,16-17,21H2,1-8H3,(H,31,35)(H,32,34)(H,33,36) |
| InChIKey | GUGCHAGTQXVJQJ-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.79 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|