C24H18N4O8S2 — CID 15404181
[(Z)-[cyano-[3-[(Z)-C-cyano-N-(4-methoxyphenyl)sulfonyloxycarbonimidoyl]phenyl]methylidene]amino] 4-methoxybenzenesulfonate (PubChem CID 15404181) has the molecular formula C24H18N4O8S2 and a molecular weight of 554.56 g/mol. Its IUPAC name is [(Z)-[cyano-[3-[(Z)-C-cyano-N-(4-methoxyphenyl)sulfonyloxycarbonimidoyl]phenyl]methylidene]amino] 4-methoxybenzenesulfonate.
| Compound Name | [(Z)-[cyano-[3-[(Z)-C-cyano-N-(4-methoxyphenyl)sulfonyloxycarbonimidoyl]phenyl]methylidene]amino] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 15404181 |
| Molecular Formula | C24H18N4O8S2 |
| Molecular Weight | 554.56 g/mol |
| Exact Mass | 554.06 |
| IUPAC Name | [(Z)-[cyano-[3-[(Z)-C-cyano-N-(4-methoxyphenyl)sulfonyloxycarbonimidoyl]phenyl]methylidene]amino] 4-methoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)O/N=C(\C#N)c2cccc(/C(C#N)=N/OS(=O)(=O)c3ccc(OC)cc3)c2)cc1 |
| InChI | InChI=1S/C24H18N4O8S2/c1-33-19-6-10-21(11-7-19)37(29,30)35-27-23(15-25)17-4-3-5-18(14-17)24(16-26)28-36-38(31,32)22-12-8-20(34-2)9-13-22/h3-14H,1-2H3/b27-23+,28-24+ |
| InChIKey | YLQVFPUTBANHEH-LMCGJEQXSA-N |
| XLogP | 2.97 |
| TPSA | 177.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.56 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|