C20H20F6N6O — CID 154046919
3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N-(2,6-diazaspiro[3.4]octan-6-ylmethyl)prop-2-enamide (PubChem CID 154046919) has the molecular formula C20H20F6N6O and a molecular weight of 474.41 g/mol. Its IUPAC name is 3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N-(2,6-diazaspiro[3.4]octan-6-ylmethyl)prop-2-enamide.
| Compound Name | 3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N-(2,6-diazaspiro[3.4]octan-6-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 154046919 |
| Molecular Formula | C20H20F6N6O |
| Molecular Weight | 474.41 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N-(2,6-diazaspiro[3.4]octan-6-ylmethyl)prop-2-enamide |
| SMILES | O=C(C=Cn1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)NCN1CCC2(CNC2)C1 |
| InChI | InChI=1S/C20H20F6N6O/c21-19(22,23)14-5-13(6-15(7-14)20(24,25)26)17-29-12-32(30-17)3-1-16(33)28-11-31-4-2-18(10-31)8-27-9-18/h1,3,5-7,12,27H,2,4,8-11H2,(H,28,33) |
| InChIKey | DUISHHXGZZDQBE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|