C17H34N2O4Si — CID 154049400
tert-butyl (3S,6R)-1-amino-6-[tert-butyl(dimethyl)silyl]oxy-2-oxoazepane-3-carboxylate (PubChem CID 154049400) has the molecular formula C17H34N2O4Si and a molecular weight of 358.56 g/mol. Its IUPAC name is tert-butyl (3S,6R)-1-amino-6-[tert-butyl(dimethyl)silyl]oxy-2-oxoazepane-3-carboxylate.
| Compound Name | tert-butyl (3S,6R)-1-amino-6-[tert-butyl(dimethyl)silyl]oxy-2-oxoazepane-3-carboxylate |
|---|---|
| PubChem CID | 154049400 |
| Molecular Formula | C17H34N2O4Si |
| Molecular Weight | 358.56 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | tert-butyl (3S,6R)-1-amino-6-[tert-butyl(dimethyl)silyl]oxy-2-oxoazepane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1CC[C@@H](O[Si](C)(C)C(C)(C)C)CN(N)C1=O |
| InChI | InChI=1S/C17H34N2O4Si/c1-16(2,3)22-15(21)13-10-9-12(11-19(18)14(13)20)23-24(7,8)17(4,5)6/h12-13H,9-11,18H2,1-8H3/t12-,13+/m1/s1 |
| InChIKey | QMZMJLCXJJUEQV-OLZOCXBDSA-N |
| XLogP | 2.83 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.56 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|