C2H4O3P+ — CID 154096929
4-methyl-1,3,2-dioxaphosphetan-2-ium 2-oxide (PubChem CID 154096929) has the molecular formula C2H4O3P+ and a molecular weight of 107.02 g/mol. Its IUPAC name is 4-methyl-1,3,2-dioxaphosphetan-2-ium 2-oxide.
| Compound Name | 4-methyl-1,3,2-dioxaphosphetan-2-ium 2-oxide |
|---|---|
| PubChem CID | 154096929 |
| Molecular Formula | C2H4O3P+ |
| Molecular Weight | 107.02 g/mol |
| Exact Mass | 106.99 |
| IUPAC Name | 4-methyl-1,3,2-dioxaphosphetan-2-ium 2-oxide |
| SMILES | CC1O[P+](=O)O1 |
| InChI | InChI=1S/C2H4O3P/c1-2-4-6(3)5-2/h2H,1H3/q+1 |
| InChIKey | SFKBZILPNYQHIV-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 107.02 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|