C17H21F3N2O2 — CID 154111247
tert-butyl N-[2-[[5-(trifluoromethyl)-2-pyridinyl]methylidene]cyclopentyl]carbamate (PubChem CID 154111247) has the molecular formula C17H21F3N2O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-(trifluoromethyl)-2-pyridinyl]methylidene]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-(trifluoromethyl)-2-pyridinyl]methylidene]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 154111247 |
| Molecular Formula | C17H21F3N2O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | tert-butyl N-[2-[[5-(trifluoromethyl)-2-pyridinyl]methylidene]cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCC1=Cc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C17H21F3N2O2/c1-16(2,3)24-15(23)22-14-6-4-5-11(14)9-13-8-7-12(10-21-13)17(18,19)20/h7-10,14H,4-6H2,1-3H3,(H,22,23) |
| InChIKey | RXFLPZRDHYEVLH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |