C13H28N4O2Si — CID 154132214
1,3-diethyl-1-[[ethyl(ethylcarbamoyl)amino]-prop-1-enylsilyl]urea (PubChem CID 154132214) has the molecular formula C13H28N4O2Si and a molecular weight of 300.48 g/mol. Its IUPAC name is 1,3-diethyl-1-[[ethyl(ethylcarbamoyl)amino]-prop-1-enylsilyl]urea.
| Compound Name | 1,3-diethyl-1-[[ethyl(ethylcarbamoyl)amino]-prop-1-enylsilyl]urea |
|---|---|
| PubChem CID | 154132214 |
| Molecular Formula | C13H28N4O2Si |
| Molecular Weight | 300.48 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 1,3-diethyl-1-[[ethyl(ethylcarbamoyl)amino]-prop-1-enylsilyl]urea |
| SMILES | CC=C[SiH](N(CC)C(=O)NCC)N(CC)C(=O)NCC |
| InChI | InChI=1S/C13H28N4O2Si/c1-6-11-20(16(9-4)12(18)14-7-2)17(10-5)13(19)15-8-3/h6,11,20H,7-10H2,1-5H3,(H,14,18)(H,15,19) |
| InChIKey | SBAGTVQKGWYHSY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.48 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|