C6H15N3OS — CID 87476101
1-(aminosulfanylmethyl)-1,3-diethylurea (PubChem CID 87476101) has the molecular formula C6H15N3OS and a molecular weight of 177.27 g/mol. Its IUPAC name is 1-(aminosulfanylmethyl)-1,3-diethylurea.
| Compound Name | 1-(aminosulfanylmethyl)-1,3-diethylurea |
|---|---|
| PubChem CID | 87476101 |
| Molecular Formula | C6H15N3OS |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 1-(aminosulfanylmethyl)-1,3-diethylurea |
| SMILES | CCNC(=O)N(CC)CSN |
| InChI | InChI=1S/C6H15N3OS/c1-3-8-6(10)9(4-2)5-11-7/h3-5,7H2,1-2H3,(H,8,10) |
| InChIKey | ALFPEYCQHWPLOC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|