C17H17F3N2O4 — CID 154143150
2,3-dihydroxypropyl 2-[2-[3-(trifluoromethyl)phenyl]hydrazinyl]benzoate (PubChem CID 154143150) has the molecular formula C17H17F3N2O4 and a molecular weight of 370.33 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2-[2-[3-(trifluoromethyl)phenyl]hydrazinyl]benzoate.
| Compound Name | 2,3-dihydroxypropyl 2-[2-[3-(trifluoromethyl)phenyl]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 154143150 |
| Molecular Formula | C17H17F3N2O4 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2,3-dihydroxypropyl 2-[2-[3-(trifluoromethyl)phenyl]hydrazinyl]benzoate |
| SMILES | O=C(OCC(O)CO)c1ccccc1NNc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H17F3N2O4/c18-17(19,20)11-4-3-5-12(8-11)21-22-15-7-2-1-6-14(15)16(25)26-10-13(24)9-23/h1-8,13,21-24H,9-10H2 |
| InChIKey | LIUDMTRRLBFWLD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|