C10H16O5 — CID 154144328
1,2,3-trioxacyclotridecane-4,13-dione (PubChem CID 154144328) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is 1,2,3-trioxacyclotridecane-4,13-dione.
| Compound Name | 1,2,3-trioxacyclotridecane-4,13-dione |
|---|---|
| PubChem CID | 154144328 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 1,2,3-trioxacyclotridecane-4,13-dione |
| SMILES | O=C1CCCCCCCCC(=O)OOO1 |
| InChI | InChI=1S/C10H16O5/c11-9-7-5-3-1-2-4-6-8-10(12)14-15-13-9/h1-8H2 |
| InChIKey | NFDXCHFATMXSFO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|