C20H23NO2 — CID 15416264
(2E,4Z)-6-hydroxy-N-(2-methylpropyl)-6-naphthalen-2-ylhexa-2,4-dienamide (PubChem CID 15416264) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is (2E,4Z)-6-hydroxy-N-(2-methylpropyl)-6-naphthalen-2-ylhexa-2,4-dienamide.
| Compound Name | (2E,4Z)-6-hydroxy-N-(2-methylpropyl)-6-naphthalen-2-ylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 15416264 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (2E,4Z)-6-hydroxy-N-(2-methylpropyl)-6-naphthalen-2-ylhexa-2,4-dienamide |
| SMILES | CC(C)CNC(=O)/C=C/C=C\C(O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H23NO2/c1-15(2)14-21-20(23)10-6-5-9-19(22)18-12-11-16-7-3-4-8-17(16)13-18/h3-13,15,19,22H,14H2,1-2H3,(H,21,23)/b9-5-,10-6+ |
| InChIKey | QAYRIPZGWLXCFP-VTBWALSUSA-N |
| XLogP | 3.76 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|