C19H29N — CID 154162701
(10S,13S,14R)-10,13-dimethyl-2,3,6,7,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-amine (PubChem CID 154162701) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is (10S,13S,14R)-10,13-dimethyl-2,3,6,7,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-amine.
| Compound Name | (10S,13S,14R)-10,13-dimethyl-2,3,6,7,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-amine |
|---|---|
| PubChem CID | 154162701 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | (10S,13S,14R)-10,13-dimethyl-2,3,6,7,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-amine |
| SMILES | C[C@]12CCC(N)C=C1CCC1=C2CC[C@]2(C)CCC[C@@H]12 |
| InChI | InChI=1S/C19H29N/c1-18-9-3-4-16(18)15-6-5-13-12-14(20)7-11-19(13,2)17(15)8-10-18/h12,14,16H,3-11,20H2,1-2H3/t14?,16-,18-,19-/m0/s1 |
| InChIKey | WTEXXJFAPWDPEF-GVDBCLODSA-N |
| XLogP | 4.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|