C18H20NO4P — CID 154174196
2-(4-diethoxyphosphoryl-2-methylphenyl)-1,3-benzoxazole (PubChem CID 154174196) has the molecular formula C18H20NO4P and a molecular weight of 345.34 g/mol. Its IUPAC name is 2-(4-diethoxyphosphoryl-2-methylphenyl)-1,3-benzoxazole.
| Compound Name | 2-(4-diethoxyphosphoryl-2-methylphenyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 154174196 |
| Molecular Formula | C18H20NO4P |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2-(4-diethoxyphosphoryl-2-methylphenyl)-1,3-benzoxazole |
| SMILES | CCOP(=O)(OCC)c1ccc(-c2nc3ccccc3o2)c(C)c1 |
| InChI | InChI=1S/C18H20NO4P/c1-4-21-24(20,22-5-2)14-10-11-15(13(3)12-14)18-19-16-8-6-7-9-17(16)23-18/h6-12H,4-5H2,1-3H3 |
| InChIKey | OFCFRSSLXZFMEK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|