C22H12Br3NO5 — CID 154184581
[2,4,6-tribromo-3-[(1,3-dioxoisoindol-2-yl)oxymethyl]phenyl] benzoate (PubChem CID 154184581) has the molecular formula C22H12Br3NO5 and a molecular weight of 610.05 g/mol. Its IUPAC name is [2,4,6-tribromo-3-[(1,3-dioxoisoindol-2-yl)oxymethyl]phenyl] benzoate.
| Compound Name | [2,4,6-tribromo-3-[(1,3-dioxoisoindol-2-yl)oxymethyl]phenyl] benzoate |
|---|---|
| PubChem CID | 154184581 |
| Molecular Formula | C22H12Br3NO5 |
| Molecular Weight | 610.05 g/mol |
| Exact Mass | 606.83 |
| IUPAC Name | [2,4,6-tribromo-3-[(1,3-dioxoisoindol-2-yl)oxymethyl]phenyl] benzoate |
| SMILES | O=C(Oc1c(Br)cc(Br)c(CON2C(=O)c3ccccc3C2=O)c1Br)c1ccccc1 |
| InChI | InChI=1S/C22H12Br3NO5/c23-16-10-17(24)19(31-22(29)12-6-2-1-3-7-12)18(25)15(16)11-30-26-20(27)13-8-4-5-9-14(13)21(26)28/h1-10H,11H2 |
| InChIKey | BWGXFKPTRYKYJX-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.05 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|