About [1-hydroxy-2-(2-hydroxyethoxy)ethyl] 2-butoxyacetate
[1-hydroxy-2-(2-hydroxyethoxy)ethyl] 2-butoxyacetate (PubChem CID 154184788) has the molecular formula C10H20O6
and a molecular weight of 236.26 g/mol. Its IUPAC name is [1-hydroxy-2-(2-hydroxyethoxy)ethyl] 2-butoxyacetate.
Molecular Properties
| Compound Name | [1-hydroxy-2-(2-hydroxyethoxy)ethyl] 2-butoxyacetate |
| PubChem CID | 154184788 |
| Molecular Formula | C10H20O6 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | [1-hydroxy-2-(2-hydroxyethoxy)ethyl] 2-butoxyacetate |
| SMILES | CCCCOCC(=O)OC(O)COCCO |
| InChI | InChI=1S/C10H20O6/c1-2-3-5-14-7-9(12)16-10(13)8-15-6-4-11/h10-11,13H,2-8H2,1H3 |
| InChIKey | GENKZXCIAAMSAC-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [1-hydroxy-2-(2-hydroxyethoxy)ethyl] 2-butoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-hydroxy-2-(2-hydroxyethoxy)ethyl] 2-butoxyacetate?
The IUPAC name of [1-hydroxy-2-(2-hydroxyethoxy)ethyl] 2-butoxyacetate (CID 154184788) is [1-hydroxy-2-(2-hydroxyethoxy)ethyl] 2-butoxyacetate.
What is the SMILES notation for [1-hydroxy-2-(2-hydroxyethoxy)ethyl] 2-butoxyacetate?
The canonical SMILES for [1-hydroxy-2-(2-hydroxyethoxy)ethyl] 2-butoxyacetate is CCCCOCC(=O)OC(O)COCCO.
What is the InChIKey of [1-hydroxy-2-(2-hydroxyethoxy)ethyl] 2-butoxyacetate?
The InChIKey is GENKZXCIAAMSAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O6/c1-2-3-5-14-7-9(12)16-10(13)8-15-6-4-11/h10-11,13H,2-8H2,1H3.
What are the key properties of [1-hydroxy-2-(2-hydroxyethoxy)ethyl] 2-butoxyacetate?
[1-hydroxy-2-(2-hydroxyethoxy)ethyl] 2-butoxyacetate has a molecular weight of 236.26 g/mol, XLogP of -0.33, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-hydroxy-2-(2-hydroxyethoxy)ethyl] 2-butoxyacetate is sourced from PubChem (CID 154184788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).