C18H21NOS2 — CID 15418860
(1R,3S,7S,9R)-15-phenyl-2-oxa-8,16-dithia-14-azatetracyclo[7.4.3.01,9.03,7]hexadec-14-ene (PubChem CID 15418860) has the molecular formula C18H21NOS2 and a molecular weight of 331.51 g/mol. Its IUPAC name is (1R,3S,7S,9R)-15-phenyl-2-oxa-8,16-dithia-14-azatetracyclo[7.4.3.01,9.03,7]hexadec-14-ene.
| Compound Name | (1R,3S,7S,9R)-15-phenyl-2-oxa-8,16-dithia-14-azatetracyclo[7.4.3.01,9.03,7]hexadec-14-ene |
|---|---|
| PubChem CID | 15418860 |
| Molecular Formula | C18H21NOS2 |
| Molecular Weight | 331.51 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (1R,3S,7S,9R)-15-phenyl-2-oxa-8,16-dithia-14-azatetracyclo[7.4.3.01,9.03,7]hexadec-14-ene |
| SMILES | c1ccc(C2=N[C@@]34CCCC[C@]3(S2)S[C@H]2CCC[C@@H]2O4)cc1 |
| InChI | InChI=1S/C18H21NOS2/c1-2-7-13(8-3-1)16-19-17-11-4-5-12-18(17,22-16)21-15-10-6-9-14(15)20-17/h1-3,7-8,14-15H,4-6,9-12H2/t14-,15-,17+,18+/m0/s1 |
| InChIKey | YPNDUABQAUQRFL-CWLKWCNXSA-N |
| XLogP | 4.83 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |