C11H9NS — CID 154190727
2,3-dihydrothieno[3,2-c]quinoline (PubChem CID 154190727) has the molecular formula C11H9NS and a molecular weight of 187.27 g/mol. Its IUPAC name is 2,3-dihydrothieno[3,2-c]quinoline.
| Compound Name | 2,3-dihydrothieno[3,2-c]quinoline |
|---|---|
| PubChem CID | 154190727 |
| Molecular Formula | C11H9NS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 2,3-dihydrothieno[3,2-c]quinoline |
| SMILES | c1ccc2c3c(cnc2c1)CCS3 |
| InChI | InChI=1S/C11H9NS/c1-2-4-10-9(3-1)11-8(7-12-10)5-6-13-11/h1-4,7H,5-6H2 |
| InChIKey | WUDTTZKUHIULJE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |