C44H62N4 — CID 15421015
5,10,15,20-tetrahexyl-21,22-dihydroporphyrin (PubChem CID 15421015) has the molecular formula C44H62N4 and a molecular weight of 647.01 g/mol. Its IUPAC name is 5,10,15,20-tetrahexyl-21,22-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrahexyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 15421015 |
| Molecular Formula | C44H62N4 |
| Molecular Weight | 647.01 g/mol |
| Exact Mass | 646.50 |
| IUPAC Name | 5,10,15,20-tetrahexyl-21,22-dihydroporphyrin |
| SMILES | CCCCCCc1c2nc(c(CCCCCC)c3ccc([nH]3)c(CCCCCC)c3ccc([nH]3)c(CCCCCC)c3nc1C=C3)C=C2 |
| InChI | InChI=1S/C44H62N4/c1-5-9-13-17-21-33-37-25-27-39(45-37)34(22-18-14-10-6-2)41-29-31-43(47-41)36(24-20-16-12-8-4)44-32-30-42(48-44)35(23-19-15-11-7-3)40-28-26-38(33)46-40/h25-32,45-46H,5-24H2,1-4H3/b37-33-,38-33-,39-34-,40-35-,41-34-,42-35-,43-36-,44-36- |
| InChIKey | CEPFXVMKPJUTFT-NKNGOTKRSA-N |
| XLogP | 13.15 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.01 |
| LogP ≤ 5 | 13.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|