C18H21ClN2O4 — CID 154212259
N-methyl-N-[4-methyl-3-(2-morpholin-4-ylethyl)-2-oxochromen-7-yl]carbamoyl chloride (PubChem CID 154212259) has the molecular formula C18H21ClN2O4 and a molecular weight of 364.83 g/mol. Its IUPAC name is N-methyl-N-[4-methyl-3-(2-morpholin-4-ylethyl)-2-oxochromen-7-yl]carbamoyl chloride.
| Compound Name | N-methyl-N-[4-methyl-3-(2-morpholin-4-ylethyl)-2-oxochromen-7-yl]carbamoyl chloride |
|---|---|
| PubChem CID | 154212259 |
| Molecular Formula | C18H21ClN2O4 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-methyl-N-[4-methyl-3-(2-morpholin-4-ylethyl)-2-oxochromen-7-yl]carbamoyl chloride |
| SMILES | Cc1c(CCN2CCOCC2)c(=O)oc2cc(N(C)C(=O)Cl)ccc12 |
| InChI | InChI=1S/C18H21ClN2O4/c1-12-14-4-3-13(20(2)18(19)23)11-16(14)25-17(22)15(12)5-6-21-7-9-24-10-8-21/h3-4,11H,5-10H2,1-2H3 |
| InChIKey | ADFUDMFLYLOWBN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|