C12H9NS — CID 154212483
2H-[1]benzothiolo[2,3-c]azepine (PubChem CID 154212483) has the molecular formula C12H9NS and a molecular weight of 199.28 g/mol. Its IUPAC name is 2H-[1]benzothiolo[2,3-c]azepine.
| Compound Name | 2H-[1]benzothiolo[2,3-c]azepine |
|---|---|
| PubChem CID | 154212483 |
| Molecular Formula | C12H9NS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 2H-[1]benzothiolo[2,3-c]azepine |
| SMILES | C1=CNC=c2sc3ccccc3c2=C1 |
| InChI | InChI=1S/C12H9NS/c1-2-6-11-9(4-1)10-5-3-7-13-8-12(10)14-11/h1-8,13H |
| InChIKey | HRFGPYNKOYYXDF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |