C17H9PS2 — CID 177415127
10,14-dithia-12-phosphapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4,6,8,11,15,17,19-nonaene (PubChem CID 177415127) has the molecular formula C17H9PS2 and a molecular weight of 308.37 g/mol. Its IUPAC name is 10,14-dithia-12-phosphapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4,6,8,11,15,17,19-nonaene.
| Compound Name | 10,14-dithia-12-phosphapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4,6,8,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 177415127 |
| Molecular Formula | C17H9PS2 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | 10,14-dithia-12-phosphapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4,6,8,11,15,17,19-nonaene |
| SMILES | c1ccc2c(c1)sc1pc3sc4ccccc4c3cc12 |
| InChI | InChI=1S/C17H9PS2/c1-3-7-14-10(5-1)12-9-13-11-6-2-4-8-15(11)20-17(13)18-16(12)19-14/h1-9H |
| InChIKey | WHNADDMJCIHWAM-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |