C26H22N2O2 — CID 154227874
3-(2-methylpropyl)perylene-1,2-dicarboxamide (PubChem CID 154227874) has the molecular formula C26H22N2O2 and a molecular weight of 394.47 g/mol. Its IUPAC name is 3-(2-methylpropyl)perylene-1,2-dicarboxamide.
| Compound Name | 3-(2-methylpropyl)perylene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 154227874 |
| Molecular Formula | C26H22N2O2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 3-(2-methylpropyl)perylene-1,2-dicarboxamide |
| SMILES | CC(C)Cc1c(C(N)=O)c(C(N)=O)c2c3cccc4cccc(c5cccc1c52)c43 |
| InChI | InChI=1S/C26H22N2O2/c1-13(2)12-19-17-10-5-9-16-15-8-3-6-14-7-4-11-18(20(14)15)22(21(16)17)24(26(28)30)23(19)25(27)29/h3-11,13H,12H2,1-2H3,(H2,27,29)(H2,28,30) |
| InChIKey | AXQMNRCBUCMOKU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|