About 1-chloro-2H-benzo[e][1,3]benzoxazole
1-chloro-2H-benzo[e][1,3]benzoxazole (PubChem CID 154258852) has the molecular formula C11H8ClNO
and a molecular weight of 205.64 g/mol. Its IUPAC name is 1-chloro-2H-benzo[e][1,3]benzoxazole.
Molecular Properties
| Compound Name | 1-chloro-2H-benzo[e][1,3]benzoxazole |
| PubChem CID | 154258852 |
| Molecular Formula | C11H8ClNO |
| Molecular Weight | 205.64 g/mol |
| Exact Mass | 205.03 |
| IUPAC Name | 1-chloro-2H-benzo[e][1,3]benzoxazole |
| SMILES | ClN1COc2ccc3ccccc3c21 |
| InChI | InChI=1S/C11H8ClNO/c12-13-7-14-10-6-5-8-3-1-2-4-9(8)11(10)13/h1-6H,7H2 |
| InChIKey | ODUHSDOXJGNCMP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.64 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2H-benzo[e][1,3]benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2H-benzo[e][1,3]benzoxazole?
The IUPAC name of 1-chloro-2H-benzo[e][1,3]benzoxazole (CID 154258852) is 1-chloro-2H-benzo[e][1,3]benzoxazole.
What is the SMILES notation for 1-chloro-2H-benzo[e][1,3]benzoxazole?
The canonical SMILES for 1-chloro-2H-benzo[e][1,3]benzoxazole is ClN1COc2ccc3ccccc3c21.
What is the InChIKey of 1-chloro-2H-benzo[e][1,3]benzoxazole?
The InChIKey is ODUHSDOXJGNCMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClNO/c12-13-7-14-10-6-5-8-3-1-2-4-9(8)11(10)13/h1-6H,7H2.
What are the key properties of 1-chloro-2H-benzo[e][1,3]benzoxazole?
1-chloro-2H-benzo[e][1,3]benzoxazole has a molecular weight of 205.64 g/mol, XLogP of 3.15, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2H-benzo[e][1,3]benzoxazole is sourced from PubChem (CID 154258852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).