C20H11BrCl2F3NO2 — CID 154270745
3-(4-bromophenyl)-5-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-hydroxybenzamide (PubChem CID 154270745) has the molecular formula C20H11BrCl2F3NO2 and a molecular weight of 505.12 g/mol. Its IUPAC name is 3-(4-bromophenyl)-5-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-hydroxybenzamide.
| Compound Name | 3-(4-bromophenyl)-5-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 154270745 |
| Molecular Formula | C20H11BrCl2F3NO2 |
| Molecular Weight | 505.12 g/mol |
| Exact Mass | 502.93 |
| IUPAC Name | 3-(4-bromophenyl)-5-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-hydroxybenzamide |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)c1cc(Cl)cc(-c2ccc(Br)cc2)c1O |
| InChI | InChI=1S/C20H11BrCl2F3NO2/c21-11-3-1-10(2-4-11)14-7-12(22)8-15(18(14)28)19(29)27-13-5-6-17(23)16(9-13)20(24,25)26/h1-9,28H,(H,27,29) |
| InChIKey | YMUYLMVSMXFADR-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.12 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |