C13H12Br2F4N4O4 — CID 154331347
N-(3-amino-5-nitro-2-pyridinyl)-4-bromo-N-(4-bromo-2,2-difluorobutanoyl)-2,2-difluorobutanamide (PubChem CID 154331347) has the molecular formula C13H12Br2F4N4O4 and a molecular weight of 524.06 g/mol. Its IUPAC name is N-(3-amino-5-nitro-2-pyridinyl)-4-bromo-N-(4-bromo-2,2-difluorobutanoyl)-2,2-difluorobutanamide.
| Compound Name | N-(3-amino-5-nitro-2-pyridinyl)-4-bromo-N-(4-bromo-2,2-difluorobutanoyl)-2,2-difluorobutanamide |
|---|---|
| PubChem CID | 154331347 |
| Molecular Formula | C13H12Br2F4N4O4 |
| Molecular Weight | 524.06 g/mol |
| Exact Mass | 521.92 |
| IUPAC Name | N-(3-amino-5-nitro-2-pyridinyl)-4-bromo-N-(4-bromo-2,2-difluorobutanoyl)-2,2-difluorobutanamide |
| SMILES | Nc1cc([N+](=O)[O-])cnc1N(C(=O)C(F)(F)CCBr)C(=O)C(F)(F)CCBr |
| InChI | InChI=1S/C13H12Br2F4N4O4/c14-3-1-12(16,17)10(24)22(11(25)13(18,19)2-4-15)9-8(20)5-7(6-21-9)23(26)27/h5-6H,1-4,20H2 |
| InChIKey | KEVCXRCBVSCOKS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.06 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|