About N-(1,3-oxazol-4-ylmethyl)-1,3-thiazole-5-carboxamide
N-(1,3-oxazol-4-ylmethyl)-1,3-thiazole-5-carboxamide (PubChem CID 154355633) has the molecular formula C8H7N3O2S
and a molecular weight of 209.23 g/mol. Its IUPAC name is N-(1,3-oxazol-4-ylmethyl)-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(1,3-oxazol-4-ylmethyl)-1,3-thiazole-5-carboxamide |
| PubChem CID | 154355633 |
| Molecular Formula | C8H7N3O2S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | N-(1,3-oxazol-4-ylmethyl)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NCc1cocn1)c1cncs1 |
| InChI | InChI=1S/C8H7N3O2S/c12-8(7-2-9-5-14-7)10-1-6-3-13-4-11-6/h2-5H,1H2,(H,10,12) |
| InChIKey | YQMHTXZFWRUBJJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1,3-oxazol-4-ylmethyl)-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-oxazol-4-ylmethyl)-1,3-thiazole-5-carboxamide?
The IUPAC name of N-(1,3-oxazol-4-ylmethyl)-1,3-thiazole-5-carboxamide (CID 154355633) is N-(1,3-oxazol-4-ylmethyl)-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-(1,3-oxazol-4-ylmethyl)-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-(1,3-oxazol-4-ylmethyl)-1,3-thiazole-5-carboxamide is O=C(NCc1cocn1)c1cncs1.
What is the InChIKey of N-(1,3-oxazol-4-ylmethyl)-1,3-thiazole-5-carboxamide?
The InChIKey is YQMHTXZFWRUBJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2S/c12-8(7-2-9-5-14-7)10-1-6-3-13-4-11-6/h2-5H,1H2,(H,10,12).
What are the key properties of N-(1,3-oxazol-4-ylmethyl)-1,3-thiazole-5-carboxamide?
N-(1,3-oxazol-4-ylmethyl)-1,3-thiazole-5-carboxamide has a molecular weight of 209.23 g/mol, XLogP of 1.06, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-oxazol-4-ylmethyl)-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 154355633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).