C7H14N2 — CID 154358308
2,4,6-trimethyl-4,5-dihydro-3H-pyridazine (PubChem CID 154358308) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is 2,4,6-trimethyl-4,5-dihydro-3H-pyridazine.
| Compound Name | 2,4,6-trimethyl-4,5-dihydro-3H-pyridazine |
|---|---|
| PubChem CID | 154358308 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 2,4,6-trimethyl-4,5-dihydro-3H-pyridazine |
| SMILES | CC1=NN(C)CC(C)C1 |
| InChI | InChI=1S/C7H14N2/c1-6-4-7(2)8-9(3)5-6/h6H,4-5H2,1-3H3 |
| InChIKey | CKKYKVDTVOIAMW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |