C7H15NO4 — CID 154362749
7-nitrosoheptane-1,2,3-triol (PubChem CID 154362749) has the molecular formula C7H15NO4 and a molecular weight of 177.20 g/mol. Its IUPAC name is 7-nitrosoheptane-1,2,3-triol.
| Compound Name | 7-nitrosoheptane-1,2,3-triol |
|---|---|
| PubChem CID | 154362749 |
| Molecular Formula | C7H15NO4 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 7-nitrosoheptane-1,2,3-triol |
| SMILES | O=NCCCCC(O)C(O)CO |
| InChI | InChI=1S/C7H15NO4/c9-5-7(11)6(10)3-1-2-4-8-12/h6-7,9-11H,1-5H2 |
| InChIKey | RBEYJTZHKDXGJH-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|