C10H9F5 — CID 154392934
2-but-1-enyl-1,5,5,6,6-pentafluorocyclohexa-1,3-diene (PubChem CID 154392934) has the molecular formula C10H9F5 and a molecular weight of 224.17 g/mol. Its IUPAC name is 2-but-1-enyl-1,5,5,6,6-pentafluorocyclohexa-1,3-diene.
| Compound Name | 2-but-1-enyl-1,5,5,6,6-pentafluorocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 154392934 |
| Molecular Formula | C10H9F5 |
| Molecular Weight | 224.17 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 2-but-1-enyl-1,5,5,6,6-pentafluorocyclohexa-1,3-diene |
| SMILES | CCC=CC1=C(F)C(F)(F)C(F)(F)C=C1 |
| InChI | InChI=1S/C10H9F5/c1-2-3-4-7-5-6-9(12,13)10(14,15)8(7)11/h3-6H,2H2,1H3 |
| InChIKey | BYVPRXPPGWTYLU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.17 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|