C7H14N4O3 — CID 154397272
1,3-dimethyl-2-nitro-1-(oxolan-2-yl)guanidine (PubChem CID 154397272) has the molecular formula C7H14N4O3 and a molecular weight of 202.21 g/mol. Its IUPAC name is 1,3-dimethyl-2-nitro-1-(oxolan-2-yl)guanidine.
| Compound Name | 1,3-dimethyl-2-nitro-1-(oxolan-2-yl)guanidine |
|---|---|
| PubChem CID | 154397272 |
| Molecular Formula | C7H14N4O3 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 1,3-dimethyl-2-nitro-1-(oxolan-2-yl)guanidine |
| SMILES | CNC(=N[N+](=O)[O-])N(C)C1CCCO1 |
| InChI | InChI=1S/C7H14N4O3/c1-8-7(9-11(12)13)10(2)6-4-3-5-14-6/h6H,3-5H2,1-2H3,(H,8,9) |
| InChIKey | XVAWQQXJAPKCFF-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|