C4H14N12O2S — CID 154405062
1-[carbamimidoyl-(diaminomethylideneamino)sulfamoyl]-1-(diaminomethylideneamino)guanidine (PubChem CID 154405062) has the molecular formula C4H14N12O2S and a molecular weight of 294.31 g/mol. Its IUPAC name is 1-[carbamimidoyl-(diaminomethylideneamino)sulfamoyl]-1-(diaminomethylideneamino)guanidine.
| Compound Name | 1-[carbamimidoyl-(diaminomethylideneamino)sulfamoyl]-1-(diaminomethylideneamino)guanidine |
|---|---|
| PubChem CID | 154405062 |
| Molecular Formula | C4H14N12O2S |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 1-[carbamimidoyl-(diaminomethylideneamino)sulfamoyl]-1-(diaminomethylideneamino)guanidine |
| SMILES | [H]/N=C(\N)N(N=C(N)N)S(=O)(=O)N(N=C(N)N)/C(N)=N/[H] |
| InChI | InChI=1S/C4H14N12O2S/c5-1(6)13-15(3(9)10)19(17,18)16(4(11)12)14-2(7)8/h(H3,9,10)(H3,11,12)(H4,5,6,13)(H4,7,8,14) |
| InChIKey | GDPHNAZHHDEGFH-UHFFFAOYSA-N |
| XLogP | -5.00 |
| TPSA | 269.16 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -5.00 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|