C14H11ClF16 — CID 154405431
2-chloro-1,1,3,4,4,5,6,6,7,7,8,8,12-tridecafluoro-9-methyl-3-(trifluoromethyl)dodec-1-ene (PubChem CID 154405431) has the molecular formula C14H11ClF16 and a molecular weight of 518.66 g/mol. Its IUPAC name is 2-chloro-1,1,3,4,4,5,6,6,7,7,8,8,12-tridecafluoro-9-methyl-3-(trifluoromethyl)dodec-1-ene.
| Compound Name | 2-chloro-1,1,3,4,4,5,6,6,7,7,8,8,12-tridecafluoro-9-methyl-3-(trifluoromethyl)dodec-1-ene |
|---|---|
| PubChem CID | 154405431 |
| Molecular Formula | C14H11ClF16 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.03 |
| IUPAC Name | 2-chloro-1,1,3,4,4,5,6,6,7,7,8,8,12-tridecafluoro-9-methyl-3-(trifluoromethyl)dodec-1-ene |
| SMILES | CC(CCCF)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)(F)C(F)(C(Cl)=C(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H11ClF16/c1-5(3-2-4-16)10(21,22)13(27,28)12(25,26)8(19)11(23,24)9(20,14(29,30)31)6(15)7(17)18/h5,8H,2-4H2,1H3 |
| InChIKey | VUTIKVYEPYXZET-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|