C11H3Cl3F16 — CID 154432879
1,2,10-trichloro-3,4,4,5,5,6,6,7,8,8,9,10,10-tridecafluoro-3-(trifluoromethyl)dec-1-ene (PubChem CID 154432879) has the molecular formula C11H3Cl3F16 and a molecular weight of 545.47 g/mol. Its IUPAC name is 1,2,10-trichloro-3,4,4,5,5,6,6,7,8,8,9,10,10-tridecafluoro-3-(trifluoromethyl)dec-1-ene.
| Compound Name | 1,2,10-trichloro-3,4,4,5,5,6,6,7,8,8,9,10,10-tridecafluoro-3-(trifluoromethyl)dec-1-ene |
|---|---|
| PubChem CID | 154432879 |
| Molecular Formula | C11H3Cl3F16 |
| Molecular Weight | 545.47 g/mol |
| Exact Mass | 543.90 |
| IUPAC Name | 1,2,10-trichloro-3,4,4,5,5,6,6,7,8,8,9,10,10-tridecafluoro-3-(trifluoromethyl)dec-1-ene |
| SMILES | FC(C(F)(F)Cl)C(F)(F)C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(Cl)=CCl)C(F)(F)F |
| InChI | InChI=1S/C11H3Cl3F16/c12-1-2(13)6(19,11(28,29)30)9(24,25)10(26,27)7(20,21)3(15)5(17,18)4(16)8(14,22)23/h1,3-4H |
| InChIKey | SGTMUCSRKRSGEQ-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.47 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|