C10H9ClF10 — CID 154411564
2-chloro-1,1,3,4,4,5,5,6,6,10-decafluorodec-1-ene (PubChem CID 154411564) has the molecular formula C10H9ClF10 and a molecular weight of 354.62 g/mol. Its IUPAC name is 2-chloro-1,1,3,4,4,5,5,6,6,10-decafluorodec-1-ene.
| Compound Name | 2-chloro-1,1,3,4,4,5,5,6,6,10-decafluorodec-1-ene |
|---|---|
| PubChem CID | 154411564 |
| Molecular Formula | C10H9ClF10 |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 2-chloro-1,1,3,4,4,5,5,6,6,10-decafluorodec-1-ene |
| SMILES | FCCCCC(F)(F)C(F)(F)C(F)(F)C(F)C(Cl)=C(F)F |
| InChI | InChI=1S/C10H9ClF10/c11-5(7(14)15)6(13)9(18,19)10(20,21)8(16,17)3-1-2-4-12/h6H,1-4H2 |
| InChIKey | ZXBYPYYZRHNJEL-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|