C20H13EuF3N2O2S — CID 154406697
europium;1,10-phenanthroline;4,4,4-trifluoro-3-hydroxy-1-thiophen-2-ylbut-2-en-1-one (PubChem CID 154406697) has the molecular formula C20H13EuF3N2O2S and a molecular weight of 554.36 g/mol. Its IUPAC name is europium;1,10-phenanthroline;4,4,4-trifluoro-3-hydroxy-1-thiophen-2-ylbut-2-en-1-one.
| Compound Name | europium;1,10-phenanthroline;4,4,4-trifluoro-3-hydroxy-1-thiophen-2-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 154406697 |
| Molecular Formula | C20H13EuF3N2O2S |
| Molecular Weight | 554.36 g/mol |
| Exact Mass | 554.99 |
| IUPAC Name | europium;1,10-phenanthroline;4,4,4-trifluoro-3-hydroxy-1-thiophen-2-ylbut-2-en-1-one |
| SMILES | O=C(C=C(O)C(F)(F)F)c1cccs1.[Eu].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.C8H5F3O2S.Eu/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;9-8(10,11)7(13)4-5(12)6-2-1-3-14-6;/h1-8H;1-4,13H; |
| InChIKey | AYPJKQHFSAOCIE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.36 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|