C8H6Cl3N3O2 — CID 154447483
6,7,8-trichloro-2-nitro-1,2,3,4-tetrahydroquinoxaline (PubChem CID 154447483) has the molecular formula C8H6Cl3N3O2 and a molecular weight of 282.51 g/mol. Its IUPAC name is 6,7,8-trichloro-2-nitro-1,2,3,4-tetrahydroquinoxaline.
| Compound Name | 6,7,8-trichloro-2-nitro-1,2,3,4-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 154447483 |
| Molecular Formula | C8H6Cl3N3O2 |
| Molecular Weight | 282.51 g/mol |
| Exact Mass | 280.95 |
| IUPAC Name | 6,7,8-trichloro-2-nitro-1,2,3,4-tetrahydroquinoxaline |
| SMILES | O=[N+]([O-])C1CNc2cc(Cl)c(Cl)c(Cl)c2N1 |
| InChI | InChI=1S/C8H6Cl3N3O2/c9-3-1-4-8(7(11)6(3)10)13-5(2-12-4)14(15)16/h1,5,12-13H,2H2 |
| InChIKey | QARGYIQFDVQEKO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|