C17H29NO2Si — CID 154478749
(2R)-N-benzyl-2,3,3,4,4-pentamethyl-1-silyloxypentan-1-imine oxide (PubChem CID 154478749) has the molecular formula C17H29NO2Si and a molecular weight of 307.51 g/mol. Its IUPAC name is (2R)-N-benzyl-2,3,3,4,4-pentamethyl-1-silyloxypentan-1-imine oxide.
| Compound Name | (2R)-N-benzyl-2,3,3,4,4-pentamethyl-1-silyloxypentan-1-imine oxide |
|---|---|
| PubChem CID | 154478749 |
| Molecular Formula | C17H29NO2Si |
| Molecular Weight | 307.51 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | (2R)-N-benzyl-2,3,3,4,4-pentamethyl-1-silyloxypentan-1-imine oxide |
| SMILES | C[C@@H](C(O[SiH3])=[N+]([O-])Cc1ccccc1)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H29NO2Si/c1-13(17(5,6)16(2,3)4)15(20-21)18(19)12-14-10-8-7-9-11-14/h7-11,13H,12H2,1-6,21H3/t13-/m0/s1 |
| InChIKey | VLVBPNCDNCGAHD-ZDUSSCGKSA-N |
| XLogP | 3.10 |
| TPSA | 35.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|