C21H31NO3SSi2 — CID 15448232
1-(4-methylphenyl)sulfonyl-5,7-bis(trimethylsilyl)-3,4-dihydro-2H-cyclopenta[b]pyridin-6-one (PubChem CID 15448232) has the molecular formula C21H31NO3SSi2 and a molecular weight of 433.72 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-5,7-bis(trimethylsilyl)-3,4-dihydro-2H-cyclopenta[b]pyridin-6-one.
| Compound Name | 1-(4-methylphenyl)sulfonyl-5,7-bis(trimethylsilyl)-3,4-dihydro-2H-cyclopenta[b]pyridin-6-one |
|---|---|
| PubChem CID | 15448232 |
| Molecular Formula | C21H31NO3SSi2 |
| Molecular Weight | 433.72 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-5,7-bis(trimethylsilyl)-3,4-dihydro-2H-cyclopenta[b]pyridin-6-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC3=C([Si](C)(C)C)C(=O)C([Si](C)(C)C)=C32)cc1 |
| InChI | InChI=1S/C21H31NO3SSi2/c1-15-10-12-16(13-11-15)26(24,25)22-14-8-9-17-18(22)21(28(5,6)7)19(23)20(17)27(2,3)4/h10-13H,8-9,14H2,1-7H3 |
| InChIKey | MJSFKYHAAMSQQM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.72 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|