C20H29NO3SSi2 — CID 11827691
1-(4-methylphenyl)sulfonyl-4,6-bis(trimethylsilyl)-2,3-dihydrocyclopenta[b]pyrrol-5-one (PubChem CID 11827691) has the molecular formula C20H29NO3SSi2 and a molecular weight of 419.70 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-4,6-bis(trimethylsilyl)-2,3-dihydrocyclopenta[b]pyrrol-5-one.
| Compound Name | 1-(4-methylphenyl)sulfonyl-4,6-bis(trimethylsilyl)-2,3-dihydrocyclopenta[b]pyrrol-5-one |
|---|---|
| PubChem CID | 11827691 |
| Molecular Formula | C20H29NO3SSi2 |
| Molecular Weight | 419.70 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-4,6-bis(trimethylsilyl)-2,3-dihydrocyclopenta[b]pyrrol-5-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC3=C([Si](C)(C)C)C(=O)C([Si](C)(C)C)=C32)cc1 |
| InChI | InChI=1S/C20H29NO3SSi2/c1-14-8-10-15(11-9-14)25(23,24)21-13-12-16-17(21)20(27(5,6)7)18(22)19(16)26(2,3)4/h8-11H,12-13H2,1-7H3 |
| InChIKey | AKGDYOHDIFSWTL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.70 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|