C22H33NO3SSi2 — CID 15448239
1-(4-methylphenyl)sulfonyl-6,8-bis(trimethylsilyl)-2,3,4,5-tetrahydrocyclopenta[b]azepin-7-one (PubChem CID 15448239) has the molecular formula C22H33NO3SSi2 and a molecular weight of 447.75 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-6,8-bis(trimethylsilyl)-2,3,4,5-tetrahydrocyclopenta[b]azepin-7-one.
| Compound Name | 1-(4-methylphenyl)sulfonyl-6,8-bis(trimethylsilyl)-2,3,4,5-tetrahydrocyclopenta[b]azepin-7-one |
|---|---|
| PubChem CID | 15448239 |
| Molecular Formula | C22H33NO3SSi2 |
| Molecular Weight | 447.75 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-6,8-bis(trimethylsilyl)-2,3,4,5-tetrahydrocyclopenta[b]azepin-7-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC3=C([Si](C)(C)C)C(=O)C([Si](C)(C)C)=C32)cc1 |
| InChI | InChI=1S/C22H33NO3SSi2/c1-16-11-13-17(14-12-16)27(25,26)23-15-9-8-10-18-19(23)22(29(5,6)7)20(24)21(18)28(2,3)4/h11-14H,8-10,15H2,1-7H3 |
| InChIKey | GVKRVSATCNACIK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.75 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|