C13H24O6Si — CID 154483338
3-(2,2-diethoxyacetyl)oxysilylpropyl 2-methylprop-2-enoate (PubChem CID 154483338) has the molecular formula C13H24O6Si and a molecular weight of 304.42 g/mol. Its IUPAC name is 3-(2,2-diethoxyacetyl)oxysilylpropyl 2-methylprop-2-enoate.
| Compound Name | 3-(2,2-diethoxyacetyl)oxysilylpropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154483338 |
| Molecular Formula | C13H24O6Si |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 3-(2,2-diethoxyacetyl)oxysilylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[SiH2]OC(=O)C(OCC)OCC |
| InChI | InChI=1S/C13H24O6Si/c1-5-16-13(17-6-2)12(15)19-20-9-7-8-18-11(14)10(3)4/h13H,3,5-9,20H2,1-2,4H3 |
| InChIKey | HCXRHEKQSITQCJ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|