C11H22O5Si — CID 173117468
3-(1,1-dimethoxyethoxysilyl)propyl 2-methylprop-2-enoate (PubChem CID 173117468) has the molecular formula C11H22O5Si and a molecular weight of 262.38 g/mol. Its IUPAC name is 3-(1,1-dimethoxyethoxysilyl)propyl 2-methylprop-2-enoate.
| Compound Name | 3-(1,1-dimethoxyethoxysilyl)propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 173117468 |
| Molecular Formula | C11H22O5Si |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 3-(1,1-dimethoxyethoxysilyl)propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[SiH2]OC(C)(OC)OC |
| InChI | InChI=1S/C11H22O5Si/c1-9(2)10(12)15-7-6-8-17-16-11(3,13-4)14-5/h1,6-8,17H2,2-5H3 |
| InChIKey | XLBULQXJMFXSNK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|