C12H24O6Si — CID 173151510
3-(1,1,2-trimethoxyethoxysilyl)propyl 2-methylprop-2-enoate (PubChem CID 173151510) has the molecular formula C12H24O6Si and a molecular weight of 292.40 g/mol. Its IUPAC name is 3-(1,1,2-trimethoxyethoxysilyl)propyl 2-methylprop-2-enoate.
| Compound Name | 3-(1,1,2-trimethoxyethoxysilyl)propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 173151510 |
| Molecular Formula | C12H24O6Si |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-(1,1,2-trimethoxyethoxysilyl)propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[SiH2]OC(COC)(OC)OC |
| InChI | InChI=1S/C12H24O6Si/c1-10(2)11(13)17-7-6-8-19-18-12(15-4,16-5)9-14-3/h1,6-9,19H2,2-5H3 |
| InChIKey | KAVIRLLBSBUXAV-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|